MilliporeSigma
Poly(ethylene glycol) dimethacrylate average Mn 4,000, contains MEHQ as inhibitor

Poly(ethylene glycol) dimethacrylate

Poly(ethylene glycol) dimethacrylate average Mn 4,000, contains MEHQ as inhibitor
Synonyms:
PEG dimethacrylate
Linear Formula:
C3H5C(O)(OCH2CH2)nOC(O)C3H5
CAS Number: